What is the 3-Hydroxy-2-nitropyridine?

3-Hydroxy-2-nitropyridine is yellow crystalline powder, while it's Molecular Formula is C5H4N2O3. yellow crystalline powder 3-Hydroxy-2-nitropyridine may be used in the synthesis of novel sulfonates that are potent inhibitors of cell proliferation and tubulin polymerization.

What is the CAS number for 3-Hydroxy-2-nitropyridine?

The CAS number of 3-Hydroxy-2-nitropyridine is 15128-82-2.

What is 3-Hydroxy-2-nitropyridine (15128-82-2) used for?

3-Hydroxy-2-nitropyridine is a yellow crystalline powder with unique chemical properties that make it a valuable compound in various applications, particularly in the field of pharmaceuticals and chemical synthesis.InChI:InChI=1/C5H4N2O3/c8-4-2-1-3-6-5(4)7(9)10/h1-3,8H